C36H16BF20NO5S — CID 139752876
bis(2-hydroxyethyl)-[2-(3-nitrophenyl)-2-oxoethyl]sulfanium;tetrakis(2,3,4,5,6-pentafluorophenyl)boranuide (PubChem CID 139752876) has the molecular formula C36H16BF20NO5S and a molecular weight of 965.36 g/mol. Its IUPAC name is bis(2-hydroxyethyl)-[2-(3-nitrophenyl)-2-oxoethyl]sulfanium;tetrakis(2,3,4,5,6-pentafluorophenyl)boranuide.
| Compound Name | bis(2-hydroxyethyl)-[2-(3-nitrophenyl)-2-oxoethyl]sulfanium;tetrakis(2,3,4,5,6-pentafluorophenyl)boranuide |
|---|---|
| PubChem CID | 139752876 |
| Molecular Formula | C36H16BF20NO5S |
| Molecular Weight | 965.36 g/mol |
| Exact Mass | 965.05 |
| IUPAC Name | bis(2-hydroxyethyl)-[2-(3-nitrophenyl)-2-oxoethyl]sulfanium;tetrakis(2,3,4,5,6-pentafluorophenyl)boranuide |
| SMILES | Fc1c(F)c(F)c([B-](c2c(F)c(F)c(F)c(F)c2F)(c2c(F)c(F)c(F)c(F)c2F)c2c(F)c(F)c(F)c(F)c2F)c(F)c1F.O=C(C[S+](CCO)CCO)c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C24BF20.C12H16NO5S/c26-5-1(6(27)14(35)21(42)13(5)34)25(2-7(28)15(36)22(43)16(37)8(2)29,3-9(30)17(38)23(44)18(39)10(3)31)4-11(32)19(40)24(45)20(41)12(4)33;14-4-6-19(7-5-15)9-12(16)10-2-1-3-11(8-10)13(17)18/h;1-3,8,14-15H,4-7,9H2/q-1;+1 |
| InChIKey | HBWHRBDEHQVQLI-UHFFFAOYSA-N |
| XLogP | 6.23 |
| TPSA | 100.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 64 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 965.36 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'} |
|---|