C23H25N2O+ — CID 139735284
1-benzyl-3-(4-cyclohexylphenoxy)pyrazin-1-ium (PubChem CID 139735284) has the molecular formula C23H25N2O+ and a molecular weight of 345.47 g/mol. Its IUPAC name is 1-benzyl-3-(4-cyclohexylphenoxy)pyrazin-1-ium.
| Compound Name | 1-benzyl-3-(4-cyclohexylphenoxy)pyrazin-1-ium |
|---|---|
| PubChem CID | 139735284 |
| Molecular Formula | C23H25N2O+ |
| Molecular Weight | 345.47 g/mol |
| Exact Mass | 345.20 |
| IUPAC Name | 1-benzyl-3-(4-cyclohexylphenoxy)pyrazin-1-ium |
| SMILES | c1ccc(C[n+]2ccnc(Oc3ccc(C4CCCCC4)cc3)c2)cc1 |
| InChI | InChI=1S/C23H25N2O/c1-3-7-19(8-4-1)17-25-16-15-24-23(18-25)26-22-13-11-21(12-14-22)20-9-5-2-6-10-20/h1,3-4,7-8,11-16,18,20H,2,5-6,9-10,17H2/q+1 |
| InChIKey | VWDNXAGVNPGCDK-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 26.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.47 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|