C41H21BF20N2 — CID 139736423
1-benzyl-3-cyclohexylpyrazin-1-ium;tetrakis(2,3,4,5,6-pentafluorophenyl)boranuide (PubChem CID 139736423) has the molecular formula C41H21BF20N2 and a molecular weight of 932.40 g/mol. Its IUPAC name is 1-benzyl-3-cyclohexylpyrazin-1-ium;tetrakis(2,3,4,5,6-pentafluorophenyl)boranuide.
| Compound Name | 1-benzyl-3-cyclohexylpyrazin-1-ium;tetrakis(2,3,4,5,6-pentafluorophenyl)boranuide |
|---|---|
| PubChem CID | 139736423 |
| Molecular Formula | C41H21BF20N2 |
| Molecular Weight | 932.40 g/mol |
| Exact Mass | 932.15 |
| IUPAC Name | 1-benzyl-3-cyclohexylpyrazin-1-ium;tetrakis(2,3,4,5,6-pentafluorophenyl)boranuide |
| SMILES | Fc1c(F)c(F)c([B-](c2c(F)c(F)c(F)c(F)c2F)(c2c(F)c(F)c(F)c(F)c2F)c2c(F)c(F)c(F)c(F)c2F)c(F)c1F.c1ccc(C[n+]2ccnc(C3CCCCC3)c2)cc1 |
| InChI | InChI=1S/C24BF20.C17H21N2/c26-5-1(6(27)14(35)21(42)13(5)34)25(2-7(28)15(36)22(43)16(37)8(2)29,3-9(30)17(38)23(44)18(39)10(3)31)4-11(32)19(40)24(45)20(41)12(4)33;1-3-7-15(8-4-1)13-19-12-11-18-17(14-19)16-9-5-2-6-10-16/h;1,3-4,7-8,11-12,14,16H,2,5-6,9-10,13H2/q-1;+1 |
| InChIKey | XFTOGXCVXAYEAI-UHFFFAOYSA-N |
| XLogP | 9.31 |
| TPSA | 16.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 64 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 932.40 |
| LogP ≤ 5 | 9.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|