C46H22BF27N2O3 — CID 139737856
tetrakis[3,5-bis(trifluoromethyl)phenyl]boranuide;trifluoromethyl 1-phenacylpyrazin-1-ium-2-carboxylate (PubChem CID 139737856) has the molecular formula C46H22BF27N2O3 and a molecular weight of 1174.45 g/mol. Its IUPAC name is tetrakis[3,5-bis(trifluoromethyl)phenyl]boranuide;trifluoromethyl 1-phenacylpyrazin-1-ium-2-carboxylate.
| Compound Name | tetrakis[3,5-bis(trifluoromethyl)phenyl]boranuide;trifluoromethyl 1-phenacylpyrazin-1-ium-2-carboxylate |
|---|---|
| PubChem CID | 139737856 |
| Molecular Formula | C46H22BF27N2O3 |
| Molecular Weight | 1174.45 g/mol |
| Exact Mass | 1174.13 |
| IUPAC Name | tetrakis[3,5-bis(trifluoromethyl)phenyl]boranuide;trifluoromethyl 1-phenacylpyrazin-1-ium-2-carboxylate |
| SMILES | FC(F)(F)c1cc([B-](c2cc(C(F)(F)F)cc(C(F)(F)F)c2)(c2cc(C(F)(F)F)cc(C(F)(F)F)c2)c2cc(C(F)(F)F)cc(C(F)(F)F)c2)cc(C(F)(F)F)c1.O=C(C[n+]1ccncc1C(=O)OC(F)(F)F)c1ccccc1 |
| InChI | InChI=1S/C32H12BF24.C14H10F3N2O3/c34-25(35,36)13-1-14(26(37,38)39)6-21(5-13)33(22-7-15(27(40,41)42)2-16(8-22)28(43,44)45,23-9-17(29(46,47)48)3-18(10-23)30(49,50)51)24-11-19(31(52,53)54)4-20(12-24)32(55,56)57;15-14(16,17)22-13(21)11-8-18-6-7-19(11)9-12(20)10-4-2-1-3-5-10/h1-12H;1-8H,9H2/q-1;+1 |
| InChIKey | CYNCTLUNDFZQMX-UHFFFAOYSA-N |
| XLogP | 13.14 |
| TPSA | 60.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 79 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1174.45 |
| LogP ≤ 5 | 13.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|