C17H19N2O3+ — CID 139736792
tert-butyl 1-phenacylpyrazin-1-ium-2-carboxylate (PubChem CID 139736792) has the molecular formula C17H19N2O3+ and a molecular weight of 299.35 g/mol. Its IUPAC name is tert-butyl 1-phenacylpyrazin-1-ium-2-carboxylate.
| Compound Name | tert-butyl 1-phenacylpyrazin-1-ium-2-carboxylate |
|---|---|
| PubChem CID | 139736792 |
| Molecular Formula | C17H19N2O3+ |
| Molecular Weight | 299.35 g/mol |
| Exact Mass | 299.14 |
| IUPAC Name | tert-butyl 1-phenacylpyrazin-1-ium-2-carboxylate |
| SMILES | CC(C)(C)OC(=O)c1cncc[n+]1CC(=O)c1ccccc1 |
| InChI | InChI=1S/C17H19N2O3/c1-17(2,3)22-16(21)14-11-18-9-10-19(14)12-15(20)13-7-5-4-6-8-13/h4-11H,12H2,1-3H3/q+1 |
| InChIKey | NGIQLGLVBKEHQA-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 60.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.35 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|