C38H10BF23N2O — CID 139737147
1-phenyl-2-[2-(1,2,2-trifluoroethenyl)pyrazin-1-ium-1-yl]ethanone;tetrakis(2,3,4,5,6-pentafluorophenyl)boranuide (PubChem CID 139737147) has the molecular formula C38H10BF23N2O and a molecular weight of 958.28 g/mol. Its IUPAC name is 1-phenyl-2-[2-(1,2,2-trifluoroethenyl)pyrazin-1-ium-1-yl]ethanone;tetrakis(2,3,4,5,6-pentafluorophenyl)boranuide.
| Compound Name | 1-phenyl-2-[2-(1,2,2-trifluoroethenyl)pyrazin-1-ium-1-yl]ethanone;tetrakis(2,3,4,5,6-pentafluorophenyl)boranuide |
|---|---|
| PubChem CID | 139737147 |
| Molecular Formula | C38H10BF23N2O |
| Molecular Weight | 958.28 g/mol |
| Exact Mass | 958.05 |
| IUPAC Name | 1-phenyl-2-[2-(1,2,2-trifluoroethenyl)pyrazin-1-ium-1-yl]ethanone;tetrakis(2,3,4,5,6-pentafluorophenyl)boranuide |
| SMILES | Fc1c(F)c(F)c([B-](c2c(F)c(F)c(F)c(F)c2F)(c2c(F)c(F)c(F)c(F)c2F)c2c(F)c(F)c(F)c(F)c2F)c(F)c1F.O=C(C[n+]1ccncc1C(F)=C(F)F)c1ccccc1 |
| InChI | InChI=1S/C24BF20.C14H10F3N2O/c26-5-1(6(27)14(35)21(42)13(5)34)25(2-7(28)15(36)22(43)16(37)8(2)29,3-9(30)17(38)23(44)18(39)10(3)31)4-11(32)19(40)24(45)20(41)12(4)33;15-13(14(16)17)11-8-18-6-7-19(11)9-12(20)10-4-2-1-3-5-10/h;1-8H,9H2/q-1;+1 |
| InChIKey | PINURIASOCGCKN-UHFFFAOYSA-N |
| XLogP | 8.63 |
| TPSA | 33.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 65 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 958.28 |
| LogP ≤ 5 | 8.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|