C43H13BF23NO — CID 139740174
1-phenyl-2-[1-(1,2,2-trifluoroethenyl)isoquinolin-2-ium-2-yl]ethanone;tetrakis(2,3,4,5,6-pentafluorophenyl)boranuide (PubChem CID 139740174) has the molecular formula C43H13BF23NO and a molecular weight of 1007.35 g/mol. Its IUPAC name is 1-phenyl-2-[1-(1,2,2-trifluoroethenyl)isoquinolin-2-ium-2-yl]ethanone;tetrakis(2,3,4,5,6-pentafluorophenyl)boranuide.
| Compound Name | 1-phenyl-2-[1-(1,2,2-trifluoroethenyl)isoquinolin-2-ium-2-yl]ethanone;tetrakis(2,3,4,5,6-pentafluorophenyl)boranuide |
|---|---|
| PubChem CID | 139740174 |
| Molecular Formula | C43H13BF23NO |
| Molecular Weight | 1007.35 g/mol |
| Exact Mass | 1007.07 |
| IUPAC Name | 1-phenyl-2-[1-(1,2,2-trifluoroethenyl)isoquinolin-2-ium-2-yl]ethanone;tetrakis(2,3,4,5,6-pentafluorophenyl)boranuide |
| SMILES | Fc1c(F)c(F)c([B-](c2c(F)c(F)c(F)c(F)c2F)(c2c(F)c(F)c(F)c(F)c2F)c2c(F)c(F)c(F)c(F)c2F)c(F)c1F.O=C(C[n+]1ccc2ccccc2c1C(F)=C(F)F)c1ccccc1 |
| InChI | InChI=1S/C24BF20.C19H13F3NO/c26-5-1(6(27)14(35)21(42)13(5)34)25(2-7(28)15(36)22(43)16(37)8(2)29,3-9(30)17(38)23(44)18(39)10(3)31)4-11(32)19(40)24(45)20(41)12(4)33;20-17(19(21)22)18-15-9-5-4-6-13(15)10-11-23(18)12-16(24)14-7-2-1-3-8-14/h;1-11H,12H2/q-1;+1 |
| InChIKey | OAVVBQWLFNYSDD-UHFFFAOYSA-N |
| XLogP | 10.39 |
| TPSA | 20.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 69 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1007.35 |
| LogP ≤ 5 | 10.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|