C49H20BF20NO2S — CID 139739449
2-(2-phenacylisoquinolin-2-ium-1-yl)-1-(2-sulfanylphenyl)ethanone;tetrakis(2,3,4,5,6-pentafluorophenyl)boranuide (PubChem CID 139739449) has the molecular formula C49H20BF20NO2S and a molecular weight of 1077.54 g/mol. Its IUPAC name is 2-(2-phenacylisoquinolin-2-ium-1-yl)-1-(2-sulfanylphenyl)ethanone;tetrakis(2,3,4,5,6-pentafluorophenyl)boranuide.
| Compound Name | 2-(2-phenacylisoquinolin-2-ium-1-yl)-1-(2-sulfanylphenyl)ethanone;tetrakis(2,3,4,5,6-pentafluorophenyl)boranuide |
|---|---|
| PubChem CID | 139739449 |
| Molecular Formula | C49H20BF20NO2S |
| Molecular Weight | 1077.54 g/mol |
| Exact Mass | 1077.10 |
| IUPAC Name | 2-(2-phenacylisoquinolin-2-ium-1-yl)-1-(2-sulfanylphenyl)ethanone;tetrakis(2,3,4,5,6-pentafluorophenyl)boranuide |
| SMILES | Fc1c(F)c(F)c([B-](c2c(F)c(F)c(F)c(F)c2F)(c2c(F)c(F)c(F)c(F)c2F)c2c(F)c(F)c(F)c(F)c2F)c(F)c1F.O=C(C[n+]1ccc2ccccc2c1CC(=O)c1ccccc1S)c1ccccc1 |
| InChI | InChI=1S/C25H19NO2S.C24BF20/c27-23(21-12-6-7-13-25(21)29)16-22-20-11-5-4-8-18(20)14-15-26(22)17-24(28)19-9-2-1-3-10-19;26-5-1(6(27)14(35)21(42)13(5)34)25(2-7(28)15(36)22(43)16(37)8(2)29,3-9(30)17(38)23(44)18(39)10(3)31)4-11(32)19(40)24(45)20(41)12(4)33/h1-15H,16-17H2;/q;-1/p+1 |
| InChIKey | WZGCDQUDOFIAMO-UHFFFAOYSA-O |
| XLogP | 10.57 |
| TPSA | 38.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 74 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1077.54 |
| LogP ≤ 5 | 10.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|