C25H19FNO2+ — CID 139739977
1-(2-fluorophenyl)-2-(2-phenacylisoquinolin-2-ium-1-yl)ethanone (PubChem CID 139739977) has the molecular formula C25H19FNO2+ and a molecular weight of 384.43 g/mol. Its IUPAC name is 1-(2-fluorophenyl)-2-(2-phenacylisoquinolin-2-ium-1-yl)ethanone.
| Compound Name | 1-(2-fluorophenyl)-2-(2-phenacylisoquinolin-2-ium-1-yl)ethanone |
|---|---|
| PubChem CID | 139739977 |
| Molecular Formula | C25H19FNO2+ |
| Molecular Weight | 384.43 g/mol |
| Exact Mass | 384.14 |
| IUPAC Name | 1-(2-fluorophenyl)-2-(2-phenacylisoquinolin-2-ium-1-yl)ethanone |
| SMILES | O=C(C[n+]1ccc2ccccc2c1CC(=O)c1ccccc1F)c1ccccc1 |
| InChI | InChI=1S/C25H19FNO2/c26-22-13-7-6-12-21(22)24(28)16-23-20-11-5-4-8-18(20)14-15-27(23)17-25(29)19-9-2-1-3-10-19/h1-15H,16-17H2/q+1 |
| InChIKey | PJBZMFGCXVJGOE-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 38.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.43 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|