C47H24BF20NOS — CID 139740193
1-phenyl-2-[1-(5-sulfanylhex-1-enyl)isoquinolin-2-ium-2-yl]ethanone;tetrakis(2,3,4,5,6-pentafluorophenyl)boranuide (PubChem CID 139740193) has the molecular formula C47H24BF20NOS and a molecular weight of 1041.55 g/mol. Its IUPAC name is 1-phenyl-2-[1-(5-sulfanylhex-1-enyl)isoquinolin-2-ium-2-yl]ethanone;tetrakis(2,3,4,5,6-pentafluorophenyl)boranuide.
| Compound Name | 1-phenyl-2-[1-(5-sulfanylhex-1-enyl)isoquinolin-2-ium-2-yl]ethanone;tetrakis(2,3,4,5,6-pentafluorophenyl)boranuide |
|---|---|
| PubChem CID | 139740193 |
| Molecular Formula | C47H24BF20NOS |
| Molecular Weight | 1041.55 g/mol |
| Exact Mass | 1041.14 |
| IUPAC Name | 1-phenyl-2-[1-(5-sulfanylhex-1-enyl)isoquinolin-2-ium-2-yl]ethanone;tetrakis(2,3,4,5,6-pentafluorophenyl)boranuide |
| SMILES | CC(S)CCC=Cc1c2ccccc2cc[n+]1CC(=O)c1ccccc1.Fc1c(F)c(F)c([B-](c2c(F)c(F)c(F)c(F)c2F)(c2c(F)c(F)c(F)c(F)c2F)c2c(F)c(F)c(F)c(F)c2F)c(F)c1F |
| InChI | InChI=1S/C24BF20.C23H23NOS/c26-5-1(6(27)14(35)21(42)13(5)34)25(2-7(28)15(36)22(43)16(37)8(2)29,3-9(30)17(38)23(44)18(39)10(3)31)4-11(32)19(40)24(45)20(41)12(4)33;1-18(26)9-5-8-14-22-21-13-7-6-10-19(21)15-16-24(22)17-23(25)20-11-3-2-4-12-20/h;2-4,6-8,10-16,18H,5,9,17H2,1H3/q-1;/p+1 |
| InChIKey | LPSNWIYEEQMEDN-UHFFFAOYSA-O |
| XLogP | 10.97 |
| TPSA | 20.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 71 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1041.55 |
| LogP ≤ 5 | 10.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|