C37H12BF20N3O2 — CID 139735295
1-phenacylpyrazin-1-ium-2-carboxamide;tetrakis(2,3,4,5,6-pentafluorophenyl)boranuide (PubChem CID 139735295) has the molecular formula C37H12BF20N3O2 and a molecular weight of 921.29 g/mol. Its IUPAC name is 1-phenacylpyrazin-1-ium-2-carboxamide;tetrakis(2,3,4,5,6-pentafluorophenyl)boranuide.
| Compound Name | 1-phenacylpyrazin-1-ium-2-carboxamide;tetrakis(2,3,4,5,6-pentafluorophenyl)boranuide |
|---|---|
| PubChem CID | 139735295 |
| Molecular Formula | C37H12BF20N3O2 |
| Molecular Weight | 921.29 g/mol |
| Exact Mass | 921.07 |
| IUPAC Name | 1-phenacylpyrazin-1-ium-2-carboxamide;tetrakis(2,3,4,5,6-pentafluorophenyl)boranuide |
| SMILES | Fc1c(F)c(F)c([B-](c2c(F)c(F)c(F)c(F)c2F)(c2c(F)c(F)c(F)c(F)c2F)c2c(F)c(F)c(F)c(F)c2F)c(F)c1F.NC(=O)c1cncc[n+]1CC(=O)c1ccccc1 |
| InChI | InChI=1S/C24BF20.C13H11N3O2/c26-5-1(6(27)14(35)21(42)13(5)34)25(2-7(28)15(36)22(43)16(37)8(2)29,3-9(30)17(38)23(44)18(39)10(3)31)4-11(32)19(40)24(45)20(41)12(4)33;14-13(18)11-8-15-6-7-16(11)9-12(17)10-4-2-1-3-5-10/h;1-8H,9H2,(H-,14,18)/q-1;/p+1 |
| InChIKey | KDLUKCAYKALYKT-UHFFFAOYSA-O |
| XLogP | 6.20 |
| TPSA | 76.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 63 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 921.29 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|