C49H19BF20N2O2 — CID 139736511
2-[2-(9H-fluoren-9-yloxy)pyrazin-1-ium-1-yl]-1-phenylethanone;tetrakis(2,3,4,5,6-pentafluorophenyl)boranuide (PubChem CID 139736511) has the molecular formula C49H19BF20N2O2 and a molecular weight of 1058.47 g/mol. Its IUPAC name is 2-[2-(9H-fluoren-9-yloxy)pyrazin-1-ium-1-yl]-1-phenylethanone;tetrakis(2,3,4,5,6-pentafluorophenyl)boranuide.
| Compound Name | 2-[2-(9H-fluoren-9-yloxy)pyrazin-1-ium-1-yl]-1-phenylethanone;tetrakis(2,3,4,5,6-pentafluorophenyl)boranuide |
|---|---|
| PubChem CID | 139736511 |
| Molecular Formula | C49H19BF20N2O2 |
| Molecular Weight | 1058.47 g/mol |
| Exact Mass | 1058.12 |
| IUPAC Name | 2-[2-(9H-fluoren-9-yloxy)pyrazin-1-ium-1-yl]-1-phenylethanone;tetrakis(2,3,4,5,6-pentafluorophenyl)boranuide |
| SMILES | Fc1c(F)c(F)c([B-](c2c(F)c(F)c(F)c(F)c2F)(c2c(F)c(F)c(F)c(F)c2F)c2c(F)c(F)c(F)c(F)c2F)c(F)c1F.O=C(C[n+]1ccncc1OC1c2ccccc2-c2ccccc21)c1ccccc1 |
| InChI | InChI=1S/C25H19N2O2.C24BF20/c28-23(18-8-2-1-3-9-18)17-27-15-14-26-16-24(27)29-25-21-12-6-4-10-19(21)20-11-5-7-13-22(20)25;26-5-1(6(27)14(35)21(42)13(5)34)25(2-7(28)15(36)22(43)16(37)8(2)29,3-9(30)17(38)23(44)18(39)10(3)31)4-11(32)19(40)24(45)20(41)12(4)33/h1-16,25H,17H2;/q+1;-1 |
| InChIKey | KANYYWIEYJOSSU-UHFFFAOYSA-N |
| XLogP | 10.25 |
| TPSA | 43.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 74 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1058.47 |
| LogP ≤ 5 | 10.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|