C25H22NO2+ — CID 139739211
(2,5-dimethylphenyl) 2-benzylisoquinolin-2-ium-1-carboxylate (PubChem CID 139739211) has the molecular formula C25H22NO2+ and a molecular weight of 368.46 g/mol. Its IUPAC name is (2,5-dimethylphenyl) 2-benzylisoquinolin-2-ium-1-carboxylate.
| Compound Name | (2,5-dimethylphenyl) 2-benzylisoquinolin-2-ium-1-carboxylate |
|---|---|
| PubChem CID | 139739211 |
| Molecular Formula | C25H22NO2+ |
| Molecular Weight | 368.46 g/mol |
| Exact Mass | 368.16 |
| IUPAC Name | (2,5-dimethylphenyl) 2-benzylisoquinolin-2-ium-1-carboxylate |
| SMILES | Cc1ccc(C)c(OC(=O)c2c3ccccc3cc[n+]2Cc2ccccc2)c1 |
| InChI | InChI=1S/C25H22NO2/c1-18-12-13-19(2)23(16-18)28-25(27)24-22-11-7-6-10-21(22)14-15-26(24)17-20-8-4-3-5-9-20/h3-16H,17H2,1-2H3/q+1 |
| InChIKey | YWTUJMCDZYYSNG-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 30.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.46 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|