C49H22BF20NO2 — CID 139742947
(2,5-dimethylphenyl) 1-benzylquinolin-1-ium-2-carboxylate;tetrakis(2,3,4,5,6-pentafluorophenyl)boranuide (PubChem CID 139742947) has the molecular formula C49H22BF20NO2 and a molecular weight of 1047.49 g/mol. Its IUPAC name is (2,5-dimethylphenyl) 1-benzylquinolin-1-ium-2-carboxylate;tetrakis(2,3,4,5,6-pentafluorophenyl)boranuide.
| Compound Name | (2,5-dimethylphenyl) 1-benzylquinolin-1-ium-2-carboxylate;tetrakis(2,3,4,5,6-pentafluorophenyl)boranuide |
|---|---|
| PubChem CID | 139742947 |
| Molecular Formula | C49H22BF20NO2 |
| Molecular Weight | 1047.49 g/mol |
| Exact Mass | 1047.14 |
| IUPAC Name | (2,5-dimethylphenyl) 1-benzylquinolin-1-ium-2-carboxylate;tetrakis(2,3,4,5,6-pentafluorophenyl)boranuide |
| SMILES | Cc1ccc(C)c(OC(=O)c2ccc3ccccc3[n+]2Cc2ccccc2)c1.Fc1c(F)c(F)c([B-](c2c(F)c(F)c(F)c(F)c2F)(c2c(F)c(F)c(F)c(F)c2F)c2c(F)c(F)c(F)c(F)c2F)c(F)c1F |
| InChI | InChI=1S/C25H22NO2.C24BF20/c1-18-12-13-19(2)24(16-18)28-25(27)23-15-14-21-10-6-7-11-22(21)26(23)17-20-8-4-3-5-9-20;26-5-1(6(27)14(35)21(42)13(5)34)25(2-7(28)15(36)22(43)16(37)8(2)29,3-9(30)17(38)23(44)18(39)10(3)31)4-11(32)19(40)24(45)20(41)12(4)33/h3-16H,17H2,1-2H3;/q+1;-1 |
| InChIKey | YVTVFXNKAAUDEJ-UHFFFAOYSA-N |
| XLogP | 10.86 |
| TPSA | 30.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 73 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1047.49 |
| LogP ≤ 5 | 10.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|