C57H22BF20NO2 — CID 139743157
pyren-1-yl 1-benzylquinolin-1-ium-2-carboxylate;tetrakis(2,3,4,5,6-pentafluorophenyl)boranuide (PubChem CID 139743157) has the molecular formula C57H22BF20NO2 and a molecular weight of 1143.58 g/mol. Its IUPAC name is pyren-1-yl 1-benzylquinolin-1-ium-2-carboxylate;tetrakis(2,3,4,5,6-pentafluorophenyl)boranuide.
| Compound Name | pyren-1-yl 1-benzylquinolin-1-ium-2-carboxylate;tetrakis(2,3,4,5,6-pentafluorophenyl)boranuide |
|---|---|
| PubChem CID | 139743157 |
| Molecular Formula | C57H22BF20NO2 |
| Molecular Weight | 1143.58 g/mol |
| Exact Mass | 1143.14 |
| IUPAC Name | pyren-1-yl 1-benzylquinolin-1-ium-2-carboxylate;tetrakis(2,3,4,5,6-pentafluorophenyl)boranuide |
| SMILES | Fc1c(F)c(F)c([B-](c2c(F)c(F)c(F)c(F)c2F)(c2c(F)c(F)c(F)c(F)c2F)c2c(F)c(F)c(F)c(F)c2F)c(F)c1F.O=C(Oc1ccc2ccc3cccc4ccc1c2c34)c1ccc2ccccc2[n+]1Cc1ccccc1 |
| InChI | InChI=1S/C33H22NO2.C24BF20/c35-33(29-19-16-23-9-4-5-12-28(23)34(29)21-22-7-2-1-3-8-22)36-30-20-17-26-14-13-24-10-6-11-25-15-18-27(30)32(26)31(24)25;26-5-1(6(27)14(35)21(42)13(5)34)25(2-7(28)15(36)22(43)16(37)8(2)29,3-9(30)17(38)23(44)18(39)10(3)31)4-11(32)19(40)24(45)20(41)12(4)33/h1-20H,21H2;/q+1;-1 |
| InChIKey | SCXXCTVSIZAARX-UHFFFAOYSA-N |
| XLogP | 13.14 |
| TPSA | 30.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 81 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1143.58 |
| LogP ≤ 5 | 13.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|