C41H16BF20NO — CID 139740474
2-(2,5-dimethylphenoxy)isoquinolin-2-ium;tetrakis(2,3,4,5,6-pentafluorophenyl)boranuide (PubChem CID 139740474) has the molecular formula C41H16BF20NO and a molecular weight of 929.36 g/mol. Its IUPAC name is 2-(2,5-dimethylphenoxy)isoquinolin-2-ium;tetrakis(2,3,4,5,6-pentafluorophenyl)boranuide.
| Compound Name | 2-(2,5-dimethylphenoxy)isoquinolin-2-ium;tetrakis(2,3,4,5,6-pentafluorophenyl)boranuide |
|---|---|
| PubChem CID | 139740474 |
| Molecular Formula | C41H16BF20NO |
| Molecular Weight | 929.36 g/mol |
| Exact Mass | 929.10 |
| IUPAC Name | 2-(2,5-dimethylphenoxy)isoquinolin-2-ium;tetrakis(2,3,4,5,6-pentafluorophenyl)boranuide |
| SMILES | Cc1ccc(C)c(O[n+]2ccc3ccccc3c2)c1.Fc1c(F)c(F)c([B-](c2c(F)c(F)c(F)c(F)c2F)(c2c(F)c(F)c(F)c(F)c2F)c2c(F)c(F)c(F)c(F)c2F)c(F)c1F |
| InChI | InChI=1S/C24BF20.C17H16NO/c26-5-1(6(27)14(35)21(42)13(5)34)25(2-7(28)15(36)22(43)16(37)8(2)29,3-9(30)17(38)23(44)18(39)10(3)31)4-11(32)19(40)24(45)20(41)12(4)33;1-13-7-8-14(2)17(11-13)19-18-10-9-15-5-3-4-6-16(15)12-18/h;3-12H,1-2H3/q-1;+1 |
| InChIKey | ZYFNQCUNHCTGAZ-UHFFFAOYSA-N |
| XLogP | 9.43 |
| TPSA | 13.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 64 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 929.36 |
| LogP ≤ 5 | 9.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|