C19H15FNO3+ — CID 139741489
fluoromethyl 1-phenacylquinolin-1-ium-2-carboxylate (PubChem CID 139741489) has the molecular formula C19H15FNO3+ and a molecular weight of 324.33 g/mol. Its IUPAC name is fluoromethyl 1-phenacylquinolin-1-ium-2-carboxylate.
| Compound Name | fluoromethyl 1-phenacylquinolin-1-ium-2-carboxylate |
|---|---|
| PubChem CID | 139741489 |
| Molecular Formula | C19H15FNO3+ |
| Molecular Weight | 324.33 g/mol |
| Exact Mass | 324.10 |
| IUPAC Name | fluoromethyl 1-phenacylquinolin-1-ium-2-carboxylate |
| SMILES | O=C(C[n+]1c(C(=O)OCF)ccc2ccccc21)c1ccccc1 |
| InChI | InChI=1S/C19H15FNO3/c20-13-24-19(23)17-11-10-14-6-4-5-9-16(14)21(17)12-18(22)15-7-2-1-3-8-15/h1-11H,12-13H2/q+1 |
| InChIKey | CYOQIQMZWXCQKO-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 47.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.33 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het_pyridiniums_A(39)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|