About anthracen-9-yl 1-phenacylquinolin-1-ium-2-carboxylate
anthracen-9-yl 1-phenacylquinolin-1-ium-2-carboxylate (PubChem CID 139741440) has the molecular formula C32H22NO3+
and a molecular weight of 468.53 g/mol. Its IUPAC name is anthracen-9-yl 1-phenacylquinolin-1-ium-2-carboxylate.
Molecular Properties
| Compound Name | anthracen-9-yl 1-phenacylquinolin-1-ium-2-carboxylate |
| PubChem CID | 139741440 |
| Molecular Formula | C32H22NO3+ |
| Molecular Weight | 468.53 g/mol |
| Exact Mass | 468.16 |
| IUPAC Name | anthracen-9-yl 1-phenacylquinolin-1-ium-2-carboxylate |
| SMILES | O=C(C[n+]1c(C(=O)Oc2c3ccccc3cc3ccccc23)ccc2ccccc21)c1ccccc1 |
| InChI | InChI=1S/C32H22NO3/c34-30(23-11-2-1-3-12-23)21-33-28-17-9-6-10-22(28)18-19-29(33)32(35)36-31-26-15-7-4-13-24(26)20-25-14-5-8-16-27(25)31/h1-20H,21H2/q+1 |
| InChIKey | WJBOUZUWXISDMG-UHFFFAOYSA-N |
| XLogP | 6.54 |
| TPSA | 47.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 468.53 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het_pyridiniums_A(39)', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze anthracen-9-yl 1-phenacylquinolin-1-ium-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of anthracen-9-yl 1-phenacylquinolin-1-ium-2-carboxylate?
The IUPAC name of anthracen-9-yl 1-phenacylquinolin-1-ium-2-carboxylate (CID 139741440) is anthracen-9-yl 1-phenacylquinolin-1-ium-2-carboxylate.
What is the SMILES notation for anthracen-9-yl 1-phenacylquinolin-1-ium-2-carboxylate?
The canonical SMILES for anthracen-9-yl 1-phenacylquinolin-1-ium-2-carboxylate is O=C(C[n+]1c(C(=O)Oc2c3ccccc3cc3ccccc23)ccc2ccccc21)c1ccccc1.
What is the InChIKey of anthracen-9-yl 1-phenacylquinolin-1-ium-2-carboxylate?
The InChIKey is WJBOUZUWXISDMG-UHFFFAOYSA-N. The full InChI is InChI=1S/C32H22NO3/c34-30(23-11-2-1-3-12-23)21-33-28-17-9-6-10-22(28)18-19-29(33)32(35)36-31-26-15-7-4-13-24(26)20-25-14-5-8-16-27(25)31/h1-20H,21H2/q+1.
What are the key properties of anthracen-9-yl 1-phenacylquinolin-1-ium-2-carboxylate?
anthracen-9-yl 1-phenacylquinolin-1-ium-2-carboxylate has a molecular weight of 468.53 g/mol, XLogP of 6.54, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for anthracen-9-yl 1-phenacylquinolin-1-ium-2-carboxylate is sourced from PubChem (CID 139741440), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).