C55H22BF20NO2 — CID 139742402
2-(2-phenanthren-9-yloxyquinolin-1-ium-1-yl)-1-phenylethanone;tetrakis(2,3,4,5,6-pentafluorophenyl)boranuide (PubChem CID 139742402) has the molecular formula C55H22BF20NO2 and a molecular weight of 1119.56 g/mol. Its IUPAC name is 2-(2-phenanthren-9-yloxyquinolin-1-ium-1-yl)-1-phenylethanone;tetrakis(2,3,4,5,6-pentafluorophenyl)boranuide.
| Compound Name | 2-(2-phenanthren-9-yloxyquinolin-1-ium-1-yl)-1-phenylethanone;tetrakis(2,3,4,5,6-pentafluorophenyl)boranuide |
|---|---|
| PubChem CID | 139742402 |
| Molecular Formula | C55H22BF20NO2 |
| Molecular Weight | 1119.56 g/mol |
| Exact Mass | 1119.14 |
| IUPAC Name | 2-(2-phenanthren-9-yloxyquinolin-1-ium-1-yl)-1-phenylethanone;tetrakis(2,3,4,5,6-pentafluorophenyl)boranuide |
| SMILES | Fc1c(F)c(F)c([B-](c2c(F)c(F)c(F)c(F)c2F)(c2c(F)c(F)c(F)c(F)c2F)c2c(F)c(F)c(F)c(F)c2F)c(F)c1F.O=C(C[n+]1c(Oc2cc3ccccc3c3ccccc23)ccc2ccccc21)c1ccccc1 |
| InChI | InChI=1S/C31H22NO2.C24BF20/c33-29(23-11-2-1-3-12-23)21-32-28-17-9-5-10-22(28)18-19-31(32)34-30-20-24-13-4-6-14-25(24)26-15-7-8-16-27(26)30;26-5-1(6(27)14(35)21(42)13(5)34)25(2-7(28)15(36)22(43)16(37)8(2)29,3-9(30)17(38)23(44)18(39)10(3)31)4-11(32)19(40)24(45)20(41)12(4)33/h1-20H,21H2;/q+1;-1 |
| InChIKey | PZMUUEQTTJDKRH-UHFFFAOYSA-N |
| XLogP | 12.95 |
| TPSA | 30.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 79 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1119.56 |
| LogP ≤ 5 | 12.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het_pyridiniums_A(39)', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|