C42H15BF20N2O3 — CID 139742018
2-[2-(nitromethyl)quinolin-1-ium-1-yl]-1-phenylethanone;tetrakis(2,3,4,5,6-pentafluorophenyl)boranuide (PubChem CID 139742018) has the molecular formula C42H15BF20N2O3 and a molecular weight of 986.36 g/mol. Its IUPAC name is 2-[2-(nitromethyl)quinolin-1-ium-1-yl]-1-phenylethanone;tetrakis(2,3,4,5,6-pentafluorophenyl)boranuide.
| Compound Name | 2-[2-(nitromethyl)quinolin-1-ium-1-yl]-1-phenylethanone;tetrakis(2,3,4,5,6-pentafluorophenyl)boranuide |
|---|---|
| PubChem CID | 139742018 |
| Molecular Formula | C42H15BF20N2O3 |
| Molecular Weight | 986.36 g/mol |
| Exact Mass | 986.09 |
| IUPAC Name | 2-[2-(nitromethyl)quinolin-1-ium-1-yl]-1-phenylethanone;tetrakis(2,3,4,5,6-pentafluorophenyl)boranuide |
| SMILES | Fc1c(F)c(F)c([B-](c2c(F)c(F)c(F)c(F)c2F)(c2c(F)c(F)c(F)c(F)c2F)c2c(F)c(F)c(F)c(F)c2F)c(F)c1F.O=C(C[n+]1c(C[N+](=O)[O-])ccc2ccccc21)c1ccccc1 |
| InChI | InChI=1S/C24BF20.C18H15N2O3/c26-5-1(6(27)14(35)21(42)13(5)34)25(2-7(28)15(36)22(43)16(37)8(2)29,3-9(30)17(38)23(44)18(39)10(3)31)4-11(32)19(40)24(45)20(41)12(4)33;21-18(15-7-2-1-3-8-15)13-19-16(12-20(22)23)11-10-14-6-4-5-9-17(14)19/h;1-11H,12-13H2/q-1;+1 |
| InChIKey | LZNBFXWGQVMSNE-UHFFFAOYSA-N |
| XLogP | 8.63 |
| TPSA | 64.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 68 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 986.36 |
| LogP ≤ 5 | 8.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het_pyridiniums_A(39)', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'} |
|---|