C42H15BF20N2O2 — CID 139743072
1-phenacylquinolin-1-ium-3-carboxamide;tetrakis(2,3,4,5,6-pentafluorophenyl)boranuide (PubChem CID 139743072) has the molecular formula C42H15BF20N2O2 and a molecular weight of 970.37 g/mol. Its IUPAC name is 1-phenacylquinolin-1-ium-3-carboxamide;tetrakis(2,3,4,5,6-pentafluorophenyl)boranuide.
| Compound Name | 1-phenacylquinolin-1-ium-3-carboxamide;tetrakis(2,3,4,5,6-pentafluorophenyl)boranuide |
|---|---|
| PubChem CID | 139743072 |
| Molecular Formula | C42H15BF20N2O2 |
| Molecular Weight | 970.37 g/mol |
| Exact Mass | 970.09 |
| IUPAC Name | 1-phenacylquinolin-1-ium-3-carboxamide;tetrakis(2,3,4,5,6-pentafluorophenyl)boranuide |
| SMILES | Fc1c(F)c(F)c([B-](c2c(F)c(F)c(F)c(F)c2F)(c2c(F)c(F)c(F)c(F)c2F)c2c(F)c(F)c(F)c(F)c2F)c(F)c1F.NC(=O)c1cc2ccccc2[n+](CC(=O)c2ccccc2)c1 |
| InChI | InChI=1S/C24BF20.C18H14N2O2/c26-5-1(6(27)14(35)21(42)13(5)34)25(2-7(28)15(36)22(43)16(37)8(2)29,3-9(30)17(38)23(44)18(39)10(3)31)4-11(32)19(40)24(45)20(41)12(4)33;19-18(22)15-10-14-8-4-5-9-16(14)20(11-15)12-17(21)13-6-2-1-3-7-13/h;1-11H,12H2,(H-,19,22)/q-1;/p+1 |
| InChIKey | DJOWMMPHMWBQEI-UHFFFAOYSA-O |
| XLogP | 7.96 |
| TPSA | 64.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 67 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 970.37 |
| LogP ≤ 5 | 7.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het_pyridiniums_A(39)', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|