C46H22BF20NO2 — CID 139741945
2-(2-cyclopentyloxyquinolin-1-ium-1-yl)-1-phenylethanone;tetrakis(2,3,4,5,6-pentafluorophenyl)boranuide (PubChem CID 139741945) has the molecular formula C46H22BF20NO2 and a molecular weight of 1011.46 g/mol. Its IUPAC name is 2-(2-cyclopentyloxyquinolin-1-ium-1-yl)-1-phenylethanone;tetrakis(2,3,4,5,6-pentafluorophenyl)boranuide.
| Compound Name | 2-(2-cyclopentyloxyquinolin-1-ium-1-yl)-1-phenylethanone;tetrakis(2,3,4,5,6-pentafluorophenyl)boranuide |
|---|---|
| PubChem CID | 139741945 |
| Molecular Formula | C46H22BF20NO2 |
| Molecular Weight | 1011.46 g/mol |
| Exact Mass | 1011.14 |
| IUPAC Name | 2-(2-cyclopentyloxyquinolin-1-ium-1-yl)-1-phenylethanone;tetrakis(2,3,4,5,6-pentafluorophenyl)boranuide |
| SMILES | Fc1c(F)c(F)c([B-](c2c(F)c(F)c(F)c(F)c2F)(c2c(F)c(F)c(F)c(F)c2F)c2c(F)c(F)c(F)c(F)c2F)c(F)c1F.O=C(C[n+]1c(OC2CCCC2)ccc2ccccc21)c1ccccc1 |
| InChI | InChI=1S/C24BF20.C22H22NO2/c26-5-1(6(27)14(35)21(42)13(5)34)25(2-7(28)15(36)22(43)16(37)8(2)29,3-9(30)17(38)23(44)18(39)10(3)31)4-11(32)19(40)24(45)20(41)12(4)33;24-21(18-9-2-1-3-10-18)16-23-20-13-7-4-8-17(20)14-15-22(23)25-19-11-5-6-12-19/h;1-4,7-10,13-15,19H,5-6,11-12,16H2/q-1;+1 |
| InChIKey | KMCUPGDYWHYQHM-UHFFFAOYSA-N |
| XLogP | 10.18 |
| TPSA | 30.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 70 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1011.46 |
| LogP ≤ 5 | 10.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het_pyridiniums_A(39)', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|