C21H29N3O4S — CID 139743225
4-[3-[5-(2-ethylpyrrolidin-1-yl)-1H-pyrrol-2-yl]-4-methoxyphenyl]sulfonylmorpholine (PubChem CID 139743225) has the molecular formula C21H29N3O4S and a molecular weight of 419.55 g/mol. Its IUPAC name is 4-[3-[5-(2-ethylpyrrolidin-1-yl)-1H-pyrrol-2-yl]-4-methoxyphenyl]sulfonylmorpholine.
| Compound Name | 4-[3-[5-(2-ethylpyrrolidin-1-yl)-1H-pyrrol-2-yl]-4-methoxyphenyl]sulfonylmorpholine |
|---|---|
| PubChem CID | 139743225 |
| Molecular Formula | C21H29N3O4S |
| Molecular Weight | 419.55 g/mol |
| Exact Mass | 419.19 |
| IUPAC Name | 4-[3-[5-(2-ethylpyrrolidin-1-yl)-1H-pyrrol-2-yl]-4-methoxyphenyl]sulfonylmorpholine |
| SMILES | CCC1CCCN1c1ccc(-c2cc(S(=O)(=O)N3CCOCC3)ccc2OC)[nH]1 |
| InChI | InChI=1S/C21H29N3O4S/c1-3-16-5-4-10-24(16)21-9-7-19(22-21)18-15-17(6-8-20(18)27-2)29(25,26)23-11-13-28-14-12-23/h6-9,15-16,22H,3-5,10-14H2,1-2H3 |
| InChIKey | CWCKPBLGWBETGV-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 74.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.55 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |