C29H34F6O4 — CID 139743563
hexyl 2-[1,1,1,3,3,3-hexafluoro-2-(3-hexoxycarbonylphenyl)propan-2-yl]benzoate (PubChem CID 139743563) has the molecular formula C29H34F6O4 and a molecular weight of 560.58 g/mol. Its IUPAC name is hexyl 2-[1,1,1,3,3,3-hexafluoro-2-(3-hexoxycarbonylphenyl)propan-2-yl]benzoate.
| Compound Name | hexyl 2-[1,1,1,3,3,3-hexafluoro-2-(3-hexoxycarbonylphenyl)propan-2-yl]benzoate |
|---|---|
| PubChem CID | 139743563 |
| Molecular Formula | C29H34F6O4 |
| Molecular Weight | 560.58 g/mol |
| Exact Mass | 560.24 |
| IUPAC Name | hexyl 2-[1,1,1,3,3,3-hexafluoro-2-(3-hexoxycarbonylphenyl)propan-2-yl]benzoate |
| SMILES | CCCCCCOC(=O)c1cccc(C(c2ccccc2C(=O)OCCCCCC)(C(F)(F)F)C(F)(F)F)c1 |
| InChI | InChI=1S/C29H34F6O4/c1-3-5-7-11-18-38-25(36)21-14-13-15-22(20-21)27(28(30,31)32,29(33,34)35)24-17-10-9-16-23(24)26(37)39-19-12-8-6-4-2/h9-10,13-17,20H,3-8,11-12,18-19H2,1-2H3 |
| InChIKey | RVDQZTBZIQSOJU-UHFFFAOYSA-N |
| XLogP | 8.57 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.58 |
| LogP ≤ 5 | 8.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|