C31H38F6O4 — CID 139743612
heptyl 2-[1,1,1,3,3,3-hexafluoro-2-(3-heptoxycarbonylphenyl)propan-2-yl]benzoate (PubChem CID 139743612) has the molecular formula C31H38F6O4 and a molecular weight of 588.63 g/mol. Its IUPAC name is heptyl 2-[1,1,1,3,3,3-hexafluoro-2-(3-heptoxycarbonylphenyl)propan-2-yl]benzoate.
| Compound Name | heptyl 2-[1,1,1,3,3,3-hexafluoro-2-(3-heptoxycarbonylphenyl)propan-2-yl]benzoate |
|---|---|
| PubChem CID | 139743612 |
| Molecular Formula | C31H38F6O4 |
| Molecular Weight | 588.63 g/mol |
| Exact Mass | 588.27 |
| IUPAC Name | heptyl 2-[1,1,1,3,3,3-hexafluoro-2-(3-heptoxycarbonylphenyl)propan-2-yl]benzoate |
| SMILES | CCCCCCCOC(=O)c1cccc(C(c2ccccc2C(=O)OCCCCCCC)(C(F)(F)F)C(F)(F)F)c1 |
| InChI | InChI=1S/C31H38F6O4/c1-3-5-7-9-13-20-40-27(38)23-16-15-17-24(22-23)29(30(32,33)34,31(35,36)37)26-19-12-11-18-25(26)28(39)41-21-14-10-8-6-4-2/h11-12,15-19,22H,3-10,13-14,20-21H2,1-2H3 |
| InChIKey | DKEZRCOZCTUYDK-UHFFFAOYSA-N |
| XLogP | 9.35 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.63 |
| LogP ≤ 5 | 9.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|