C21H26N4O2S — CID 139743839
1-(2,4-dimethoxyphenyl)-4-[2-(5-thiophen-2-yl-1H-pyrazol-4-yl)ethyl]piperazine (PubChem CID 139743839) has the molecular formula C21H26N4O2S and a molecular weight of 398.53 g/mol. Its IUPAC name is 1-(2,4-dimethoxyphenyl)-4-[2-(5-thiophen-2-yl-1H-pyrazol-4-yl)ethyl]piperazine.
| Compound Name | 1-(2,4-dimethoxyphenyl)-4-[2-(5-thiophen-2-yl-1H-pyrazol-4-yl)ethyl]piperazine |
|---|---|
| PubChem CID | 139743839 |
| Molecular Formula | C21H26N4O2S |
| Molecular Weight | 398.53 g/mol |
| Exact Mass | 398.18 |
| IUPAC Name | 1-(2,4-dimethoxyphenyl)-4-[2-(5-thiophen-2-yl-1H-pyrazol-4-yl)ethyl]piperazine |
| SMILES | COc1ccc(N2CCN(CCc3cn[nH]c3-c3cccs3)CC2)c(OC)c1 |
| InChI | InChI=1S/C21H26N4O2S/c1-26-17-5-6-18(19(14-17)27-2)25-11-9-24(10-12-25)8-7-16-15-22-23-21(16)20-4-3-13-28-20/h3-6,13-15H,7-12H2,1-2H3,(H,22,23) |
| InChIKey | UYYREMBIAQYMTO-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 53.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.53 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|