C19H21FN4S — CID 139743917
1-(4-fluorophenyl)-4-[(1-methyl-5-thiophen-2-ylpyrazol-3-yl)methyl]piperazine (PubChem CID 139743917) has the molecular formula C19H21FN4S and a molecular weight of 356.47 g/mol. Its IUPAC name is 1-(4-fluorophenyl)-4-[(1-methyl-5-thiophen-2-ylpyrazol-3-yl)methyl]piperazine.
| Compound Name | 1-(4-fluorophenyl)-4-[(1-methyl-5-thiophen-2-ylpyrazol-3-yl)methyl]piperazine |
|---|---|
| PubChem CID | 139743917 |
| Molecular Formula | C19H21FN4S |
| Molecular Weight | 356.47 g/mol |
| Exact Mass | 356.15 |
| IUPAC Name | 1-(4-fluorophenyl)-4-[(1-methyl-5-thiophen-2-ylpyrazol-3-yl)methyl]piperazine |
| SMILES | Cn1nc(CN2CCN(c3ccc(F)cc3)CC2)cc1-c1cccs1 |
| InChI | InChI=1S/C19H21FN4S/c1-22-18(19-3-2-12-25-19)13-16(21-22)14-23-8-10-24(11-9-23)17-6-4-15(20)5-7-17/h2-7,12-13H,8-11,14H2,1H3 |
| InChIKey | XCBNBORQXALFCB-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 24.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.47 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |