C40H14BF20NOS — CID 139744289
1-(3-benzyl-1,3-benzothiazol-3-ium-5-yl)ethanone;tetrakis(2,3,4,5,6-pentafluorophenyl)boranuide (PubChem CID 139744289) has the molecular formula C40H14BF20NOS and a molecular weight of 947.40 g/mol. Its IUPAC name is 1-(3-benzyl-1,3-benzothiazol-3-ium-5-yl)ethanone;tetrakis(2,3,4,5,6-pentafluorophenyl)boranuide.
| Compound Name | 1-(3-benzyl-1,3-benzothiazol-3-ium-5-yl)ethanone;tetrakis(2,3,4,5,6-pentafluorophenyl)boranuide |
|---|---|
| PubChem CID | 139744289 |
| Molecular Formula | C40H14BF20NOS |
| Molecular Weight | 947.40 g/mol |
| Exact Mass | 947.06 |
| IUPAC Name | 1-(3-benzyl-1,3-benzothiazol-3-ium-5-yl)ethanone;tetrakis(2,3,4,5,6-pentafluorophenyl)boranuide |
| SMILES | CC(=O)c1ccc2sc[n+](Cc3ccccc3)c2c1.Fc1c(F)c(F)c([B-](c2c(F)c(F)c(F)c(F)c2F)(c2c(F)c(F)c(F)c(F)c2F)c2c(F)c(F)c(F)c(F)c2F)c(F)c1F |
| InChI | InChI=1S/C24BF20.C16H14NOS/c26-5-1(6(27)14(35)21(42)13(5)34)25(2-7(28)15(36)22(43)16(37)8(2)29,3-9(30)17(38)23(44)18(39)10(3)31)4-11(32)19(40)24(45)20(41)12(4)33;1-12(18)14-7-8-16-15(9-14)17(11-19-16)10-13-5-3-2-4-6-13/h;2-9,11H,10H2,1H3/q-1;+1 |
| InChIKey | OUJKRHLHMFBAOK-UHFFFAOYSA-N |
| XLogP | 9.29 |
| TPSA | 20.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 64 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 947.40 |
| LogP ≤ 5 | 9.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|