C16H32N2Si2 — CID 139747022
N-methyl-1-[3-[[methyl(trimethylsilyl)amino]methyl]phenyl]-N-trimethylsilylmethanamine (PubChem CID 139747022) has the molecular formula C16H32N2Si2 and a molecular weight of 308.62 g/mol. Its IUPAC name is N-methyl-1-[3-[[methyl(trimethylsilyl)amino]methyl]phenyl]-N-trimethylsilylmethanamine.
| Compound Name | N-methyl-1-[3-[[methyl(trimethylsilyl)amino]methyl]phenyl]-N-trimethylsilylmethanamine |
|---|---|
| PubChem CID | 139747022 |
| Molecular Formula | C16H32N2Si2 |
| Molecular Weight | 308.62 g/mol |
| Exact Mass | 308.21 |
| IUPAC Name | N-methyl-1-[3-[[methyl(trimethylsilyl)amino]methyl]phenyl]-N-trimethylsilylmethanamine |
| SMILES | CN(Cc1cccc(CN(C)[Si](C)(C)C)c1)[Si](C)(C)C |
| InChI | InChI=1S/C16H32N2Si2/c1-17(19(3,4)5)13-15-10-9-11-16(12-15)14-18(2)20(6,7)8/h9-12H,13-14H2,1-8H3 |
| InChIKey | IZJNQEYTNGFMKP-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.62 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|