C16H40N2Si2 — CID 139747038
N,N'-bis(trimethylsilyl)decane-1,10-diamine (PubChem CID 139747038) has the molecular formula C16H40N2Si2 and a molecular weight of 316.68 g/mol. Its IUPAC name is N,N'-bis(trimethylsilyl)decane-1,10-diamine.
| Compound Name | N,N'-bis(trimethylsilyl)decane-1,10-diamine |
|---|---|
| PubChem CID | 139747038 |
| Molecular Formula | C16H40N2Si2 |
| Molecular Weight | 316.68 g/mol |
| Exact Mass | 316.27 |
| IUPAC Name | N,N'-bis(trimethylsilyl)decane-1,10-diamine |
| SMILES | C[Si](C)(C)NCCCCCCCCCCN[Si](C)(C)C |
| InChI | InChI=1S/C16H40N2Si2/c1-19(2,3)17-15-13-11-9-7-8-10-12-14-16-18-20(4,5)6/h17-18H,7-16H2,1-6H3 |
| InChIKey | KTPCDEHRXDRQQD-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.68 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|