C20H26N2O4S — CID 139748833
1-[3-tert-butyl-5-methoxy-2-(methoxymethoxy)phenyl]-3-(2-hydroxyphenyl)thiourea (PubChem CID 139748833) has the molecular formula C20H26N2O4S and a molecular weight of 390.51 g/mol. Its IUPAC name is 1-[3-tert-butyl-5-methoxy-2-(methoxymethoxy)phenyl]-3-(2-hydroxyphenyl)thiourea.
| Compound Name | 1-[3-tert-butyl-5-methoxy-2-(methoxymethoxy)phenyl]-3-(2-hydroxyphenyl)thiourea |
|---|---|
| PubChem CID | 139748833 |
| Molecular Formula | C20H26N2O4S |
| Molecular Weight | 390.51 g/mol |
| Exact Mass | 390.16 |
| IUPAC Name | 1-[3-tert-butyl-5-methoxy-2-(methoxymethoxy)phenyl]-3-(2-hydroxyphenyl)thiourea |
| SMILES | COCOc1c(NC(=S)Nc2ccccc2O)cc(OC)cc1C(C)(C)C |
| InChI | InChI=1S/C20H26N2O4S/c1-20(2,3)14-10-13(25-5)11-16(18(14)26-12-24-4)22-19(27)21-15-8-6-7-9-17(15)23/h6-11,23H,12H2,1-5H3,(H2,21,22,27) |
| InChIKey | JYXUWLPWJVCTFG-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 71.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.51 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|