C18H36N2O5 — CID 139749874
(2S,3R)-N,2-dihydroxy-N'-[(2S)-1-hydroxy-3-methylbutan-2-yl]-3-nonylbutanediamide (PubChem CID 139749874) has the molecular formula C18H36N2O5 and a molecular weight of 360.50 g/mol. Its IUPAC name is (2S,3R)-N,2-dihydroxy-N'-[(2S)-1-hydroxy-3-methylbutan-2-yl]-3-nonylbutanediamide.
| Compound Name | (2S,3R)-N,2-dihydroxy-N'-[(2S)-1-hydroxy-3-methylbutan-2-yl]-3-nonylbutanediamide |
|---|---|
| PubChem CID | 139749874 |
| Molecular Formula | C18H36N2O5 |
| Molecular Weight | 360.50 g/mol |
| Exact Mass | 360.26 |
| IUPAC Name | (2S,3R)-N,2-dihydroxy-N'-[(2S)-1-hydroxy-3-methylbutan-2-yl]-3-nonylbutanediamide |
| SMILES | CCCCCCCCC[C@@H](C(=O)N[C@H](CO)C(C)C)[C@H](O)C(=O)NO |
| InChI | InChI=1S/C18H36N2O5/c1-4-5-6-7-8-9-10-11-14(16(22)18(24)20-25)17(23)19-15(12-21)13(2)3/h13-16,21-22,25H,4-12H2,1-3H3,(H,19,23)(H,20,24)/t14-,15-,16+/m1/s1 |
| InChIKey | GRSROYOPFPXEIM-OAGGEKHMSA-N |
| XLogP | 1.74 |
| TPSA | 118.89 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.50 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|