C23H45N3O6 — CID 139749783
(2R,3S)-N-[(3S,4R)-6-(dimethylamino)-4-hydroxy-2,2-dimethyl-6-oxohexan-3-yl]-N',3-dihydroxy-2-nonylbutanediamide (PubChem CID 139749783) has the molecular formula C23H45N3O6 and a molecular weight of 459.63 g/mol. Its IUPAC name is (2R,3S)-N-[(3S,4R)-6-(dimethylamino)-4-hydroxy-2,2-dimethyl-6-oxohexan-3-yl]-N',3-dihydroxy-2-nonylbutanediamide.
| Compound Name | (2R,3S)-N-[(3S,4R)-6-(dimethylamino)-4-hydroxy-2,2-dimethyl-6-oxohexan-3-yl]-N',3-dihydroxy-2-nonylbutanediamide |
|---|---|
| PubChem CID | 139749783 |
| Molecular Formula | C23H45N3O6 |
| Molecular Weight | 459.63 g/mol |
| Exact Mass | 459.33 |
| IUPAC Name | (2R,3S)-N-[(3S,4R)-6-(dimethylamino)-4-hydroxy-2,2-dimethyl-6-oxohexan-3-yl]-N',3-dihydroxy-2-nonylbutanediamide |
| SMILES | CCCCCCCCC[C@@H](C(=O)N[C@H]([C@H](O)CC(=O)N(C)C)C(C)(C)C)[C@H](O)C(=O)NO |
| InChI | InChI=1S/C23H45N3O6/c1-7-8-9-10-11-12-13-14-16(19(29)22(31)25-32)21(30)24-20(23(2,3)4)17(27)15-18(28)26(5)6/h16-17,19-20,27,29,32H,7-15H2,1-6H3,(H,24,30)(H,25,31)/t16-,17-,19+,20-/m1/s1 |
| InChIKey | WVYCDTBDDJAJCL-IZBJGVDFSA-N |
| XLogP | 1.98 |
| TPSA | 139.20 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.63 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|