C30H51N3O6 — CID 139749850
(2R,3S)-N-[(3S,4R)-6-(dimethylamino)-4-hydroxy-2,2-dimethyl-6-oxohexan-3-yl]-3-hydroxy-2-nonyl-N'-phenylmethoxybutanediamide (PubChem CID 139749850) has the molecular formula C30H51N3O6 and a molecular weight of 549.75 g/mol. Its IUPAC name is (2R,3S)-N-[(3S,4R)-6-(dimethylamino)-4-hydroxy-2,2-dimethyl-6-oxohexan-3-yl]-3-hydroxy-2-nonyl-N'-phenylmethoxybutanediamide.
| Compound Name | (2R,3S)-N-[(3S,4R)-6-(dimethylamino)-4-hydroxy-2,2-dimethyl-6-oxohexan-3-yl]-3-hydroxy-2-nonyl-N'-phenylmethoxybutanediamide |
|---|---|
| PubChem CID | 139749850 |
| Molecular Formula | C30H51N3O6 |
| Molecular Weight | 549.75 g/mol |
| Exact Mass | 549.38 |
| IUPAC Name | (2R,3S)-N-[(3S,4R)-6-(dimethylamino)-4-hydroxy-2,2-dimethyl-6-oxohexan-3-yl]-3-hydroxy-2-nonyl-N'-phenylmethoxybutanediamide |
| SMILES | CCCCCCCCC[C@@H](C(=O)N[C@H]([C@H](O)CC(=O)N(C)C)C(C)(C)C)[C@H](O)C(=O)NOCc1ccccc1 |
| InChI | InChI=1S/C30H51N3O6/c1-7-8-9-10-11-12-16-19-23(26(36)29(38)32-39-21-22-17-14-13-15-18-22)28(37)31-27(30(2,3)4)24(34)20-25(35)33(5)6/h13-15,17-18,23-24,26-27,34,36H,7-12,16,19-21H2,1-6H3,(H,31,37)(H,32,38)/t23-,24-,26+,27-/m1/s1 |
| InChIKey | ZURUAQDUYDXRGH-QAPZTRRTSA-N |
| XLogP | 3.72 |
| TPSA | 128.20 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.75 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|