C13H19NaO3S — CID 139750072
sodium (2S)-2-[4-(2-methylpropyl)phenyl]propane-1-sulfonate (PubChem CID 139750072) has the molecular formula C13H19NaO3S and a molecular weight of 278.35 g/mol. Its IUPAC name is sodium (2S)-2-[4-(2-methylpropyl)phenyl]propane-1-sulfonate.
| Compound Name | sodium (2S)-2-[4-(2-methylpropyl)phenyl]propane-1-sulfonate |
|---|---|
| PubChem CID | 139750072 |
| Molecular Formula | C13H19NaO3S |
| Molecular Weight | 278.35 g/mol |
| Exact Mass | 278.10 |
| IUPAC Name | sodium (2S)-2-[4-(2-methylpropyl)phenyl]propane-1-sulfonate |
| SMILES | CC(C)Cc1ccc([C@H](C)CS(=O)(=O)[O-])cc1.[Na+] |
| InChI | InChI=1S/C13H20O3S.Na/c1-10(2)8-12-4-6-13(7-5-12)11(3)9-17(14,15)16;/h4-7,10-11H,8-9H2,1-3H3,(H,14,15,16);/q;+1/p-1/t11-;/m1./s1 |
| InChIKey | YUXMZECOEOGWKA-RFVHGSKJSA-M |
| XLogP | -0.46 |
| TPSA | 57.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.35 |
| LogP ≤ 5 | -0.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|