C36H40N4O3S — CID 139750478
N-[2-[2-(4-methyl-1,4-diazepan-1-yl)ethoxy]-4-(5,6,7,8-tetrahydrothieno[3,2-b]azepine-4-carbonyl)phenyl]-2-phenylbenzamide (PubChem CID 139750478) has the molecular formula C36H40N4O3S and a molecular weight of 608.81 g/mol. Its IUPAC name is N-[2-[2-(4-methyl-1,4-diazepan-1-yl)ethoxy]-4-(5,6,7,8-tetrahydrothieno[3,2-b]azepine-4-carbonyl)phenyl]-2-phenylbenzamide.
| Compound Name | N-[2-[2-(4-methyl-1,4-diazepan-1-yl)ethoxy]-4-(5,6,7,8-tetrahydrothieno[3,2-b]azepine-4-carbonyl)phenyl]-2-phenylbenzamide |
|---|---|
| PubChem CID | 139750478 |
| Molecular Formula | C36H40N4O3S |
| Molecular Weight | 608.81 g/mol |
| Exact Mass | 608.28 |
| IUPAC Name | N-[2-[2-(4-methyl-1,4-diazepan-1-yl)ethoxy]-4-(5,6,7,8-tetrahydrothieno[3,2-b]azepine-4-carbonyl)phenyl]-2-phenylbenzamide |
| SMILES | CN1CCCN(CCOc2cc(C(=O)N3CCCCc4sccc43)ccc2NC(=O)c2ccccc2-c2ccccc2)CC1 |
| InChI | InChI=1S/C36H40N4O3S/c1-38-18-9-19-39(22-21-38)23-24-43-33-26-28(36(42)40-20-8-7-14-34-32(40)17-25-44-34)15-16-31(33)37-35(41)30-13-6-5-12-29(30)27-10-3-2-4-11-27/h2-6,10-13,15-17,25-26H,7-9,14,18-24H2,1H3,(H,37,41) |
| InChIKey | AAVUWXYIKNXSOU-UHFFFAOYSA-N |
| XLogP | 6.67 |
| TPSA | 65.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.81 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |