C15H15NOS — CID 140983481
phenyl(5,6,7,8-tetrahydrothieno[3,2-b]azepin-4-yl)methanone (PubChem CID 140983481) has the molecular formula C15H15NOS and a molecular weight of 257.36 g/mol. Its IUPAC name is phenyl(5,6,7,8-tetrahydrothieno[3,2-b]azepin-4-yl)methanone.
| Compound Name | phenyl(5,6,7,8-tetrahydrothieno[3,2-b]azepin-4-yl)methanone |
|---|---|
| PubChem CID | 140983481 |
| Molecular Formula | C15H15NOS |
| Molecular Weight | 257.36 g/mol |
| Exact Mass | 257.09 |
| IUPAC Name | phenyl(5,6,7,8-tetrahydrothieno[3,2-b]azepin-4-yl)methanone |
| SMILES | O=C(c1ccccc1)N1CCCCc2sccc21 |
| InChI | InChI=1S/C15H15NOS/c17-15(12-6-2-1-3-7-12)16-10-5-4-8-14-13(16)9-11-18-14/h1-3,6-7,9,11H,4-5,8,10H2 |
| InChIKey | CKSQMBXKUTYXFW-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.36 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |