C17H26F3N3O — CID 139750708
N-ethyl-N'-[(4-morpholin-4-ylphenyl)methyl]-N'-(2,2,2-trifluoroethyl)ethane-1,2-diamine (PubChem CID 139750708) has the molecular formula C17H26F3N3O and a molecular weight of 345.41 g/mol. Its IUPAC name is N-ethyl-N'-[(4-morpholin-4-ylphenyl)methyl]-N'-(2,2,2-trifluoroethyl)ethane-1,2-diamine.
| Compound Name | N-ethyl-N'-[(4-morpholin-4-ylphenyl)methyl]-N'-(2,2,2-trifluoroethyl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 139750708 |
| Molecular Formula | C17H26F3N3O |
| Molecular Weight | 345.41 g/mol |
| Exact Mass | 345.20 |
| IUPAC Name | N-ethyl-N'-[(4-morpholin-4-ylphenyl)methyl]-N'-(2,2,2-trifluoroethyl)ethane-1,2-diamine |
| SMILES | CCNCCN(Cc1ccc(N2CCOCC2)cc1)CC(F)(F)F |
| InChI | InChI=1S/C17H26F3N3O/c1-2-21-7-8-22(14-17(18,19)20)13-15-3-5-16(6-4-15)23-9-11-24-12-10-23/h3-6,21H,2,7-14H2,1H3 |
| InChIKey | ZOPCBZOYVVIKTC-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 27.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.41 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|