C18H21NO5S3 — CID 139751897
[(4R)-3-(4-methylphenyl)sulfonyl-1,3-thiazolidin-4-yl]methyl 4-methylbenzenesulfonate (PubChem CID 139751897) has the molecular formula C18H21NO5S3 and a molecular weight of 427.57 g/mol. Its IUPAC name is [(4R)-3-(4-methylphenyl)sulfonyl-1,3-thiazolidin-4-yl]methyl 4-methylbenzenesulfonate.
| Compound Name | [(4R)-3-(4-methylphenyl)sulfonyl-1,3-thiazolidin-4-yl]methyl 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 139751897 |
| Molecular Formula | C18H21NO5S3 |
| Molecular Weight | 427.57 g/mol |
| Exact Mass | 427.06 |
| IUPAC Name | [(4R)-3-(4-methylphenyl)sulfonyl-1,3-thiazolidin-4-yl]methyl 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OC[C@@H]2CSCN2S(=O)(=O)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C18H21NO5S3/c1-14-3-7-17(8-4-14)26(20,21)19-13-25-12-16(19)11-24-27(22,23)18-9-5-15(2)6-10-18/h3-10,16H,11-13H2,1-2H3/t16-/m1/s1 |
| InChIKey | ABAVANPRZBWHMO-MRXNPFEDSA-N |
| XLogP | 2.77 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.57 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|