C12H8Cl2F3N3O2 — CID 139754448
N-[[2-chloro-5-[4-chloro-5-(difluoromethoxy)-1-methylpyrazol-3-yl]-4-fluorophenyl]methylidene]hydroxylamine (PubChem CID 139754448) has the molecular formula C12H8Cl2F3N3O2 and a molecular weight of 354.12 g/mol. Its IUPAC name is N-[[2-chloro-5-[4-chloro-5-(difluoromethoxy)-1-methylpyrazol-3-yl]-4-fluorophenyl]methylidene]hydroxylamine.
| Compound Name | N-[[2-chloro-5-[4-chloro-5-(difluoromethoxy)-1-methylpyrazol-3-yl]-4-fluorophenyl]methylidene]hydroxylamine |
|---|---|
| PubChem CID | 139754448 |
| Molecular Formula | C12H8Cl2F3N3O2 |
| Molecular Weight | 354.12 g/mol |
| Exact Mass | 352.99 |
| IUPAC Name | N-[[2-chloro-5-[4-chloro-5-(difluoromethoxy)-1-methylpyrazol-3-yl]-4-fluorophenyl]methylidene]hydroxylamine |
| SMILES | Cn1nc(-c2cc(C=NO)c(Cl)cc2F)c(Cl)c1OC(F)F |
| InChI | InChI=1S/C12H8Cl2F3N3O2/c1-20-11(22-12(16)17)9(14)10(19-20)6-2-5(4-18-21)7(13)3-8(6)15/h2-4,12,21H,1H3 |
| InChIKey | KDIUODZKVSMKDN-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 59.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.12 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|