C17H12Cl3F2N3O3 — CID 57065413
ethyl 2-cyano-3-[2,4-dichloro-5-[4-chloro-5-(difluoromethoxy)-1-methylpyrazol-3-yl]phenyl]prop-2-enoate (PubChem CID 57065413) has the molecular formula C17H12Cl3F2N3O3 and a molecular weight of 450.66 g/mol. Its IUPAC name is ethyl 2-cyano-3-[2,4-dichloro-5-[4-chloro-5-(difluoromethoxy)-1-methylpyrazol-3-yl]phenyl]prop-2-enoate.
| Compound Name | ethyl 2-cyano-3-[2,4-dichloro-5-[4-chloro-5-(difluoromethoxy)-1-methylpyrazol-3-yl]phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 57065413 |
| Molecular Formula | C17H12Cl3F2N3O3 |
| Molecular Weight | 450.66 g/mol |
| Exact Mass | 448.99 |
| IUPAC Name | ethyl 2-cyano-3-[2,4-dichloro-5-[4-chloro-5-(difluoromethoxy)-1-methylpyrazol-3-yl]phenyl]prop-2-enoate |
| SMILES | CCOC(=O)C(C#N)=Cc1cc(-c2nn(C)c(OC(F)F)c2Cl)c(Cl)cc1Cl |
| InChI | InChI=1S/C17H12Cl3F2N3O3/c1-3-27-16(26)9(7-23)4-8-5-10(12(19)6-11(8)18)14-13(20)15(25(2)24-14)28-17(21)22/h4-6,17H,3H2,1-2H3 |
| InChIKey | FMSKUHDFWFCJOQ-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 77.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.66 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|