C30H38O10 — CID 139754710
tritert-butyl 5-(4-ethylbenzoyl)benzene-1,2,3-tricarboperoxoate (PubChem CID 139754710) has the molecular formula C30H38O10 and a molecular weight of 558.62 g/mol. Its IUPAC name is tritert-butyl 5-(4-ethylbenzoyl)benzene-1,2,3-tricarboperoxoate.
| Compound Name | tritert-butyl 5-(4-ethylbenzoyl)benzene-1,2,3-tricarboperoxoate |
|---|---|
| PubChem CID | 139754710 |
| Molecular Formula | C30H38O10 |
| Molecular Weight | 558.62 g/mol |
| Exact Mass | 558.25 |
| IUPAC Name | tritert-butyl 5-(4-ethylbenzoyl)benzene-1,2,3-tricarboperoxoate |
| SMILES | CCc1ccc(C(=O)c2cc(C(=O)OOC(C)(C)C)c(C(=O)OOC(C)(C)C)c(C(=O)OOC(C)(C)C)c2)cc1 |
| InChI | InChI=1S/C30H38O10/c1-11-18-12-14-19(15-13-18)24(31)20-16-21(25(32)35-38-28(2,3)4)23(27(34)37-40-30(8,9)10)22(17-20)26(33)36-39-29(5,6)7/h12-17H,11H2,1-10H3 |
| InChIKey | FGSIXDORQMITIE-UHFFFAOYSA-N |
| XLogP | 6.14 |
| TPSA | 123.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.62 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|