C20H24O2P+ — CID 139755086
7,9-di(butan-2-yl)benzo[c][2,1]benzoxaphosphinin-6-ium 6-oxide (PubChem CID 139755086) has the molecular formula C20H24O2P+ and a molecular weight of 327.38 g/mol. Its IUPAC name is 7,9-di(butan-2-yl)benzo[c][2,1]benzoxaphosphinin-6-ium 6-oxide.
| Compound Name | 7,9-di(butan-2-yl)benzo[c][2,1]benzoxaphosphinin-6-ium 6-oxide |
|---|---|
| PubChem CID | 139755086 |
| Molecular Formula | C20H24O2P+ |
| Molecular Weight | 327.38 g/mol |
| Exact Mass | 327.15 |
| IUPAC Name | 7,9-di(butan-2-yl)benzo[c][2,1]benzoxaphosphinin-6-ium 6-oxide |
| SMILES | CCC(C)c1cc(C(C)CC)c2c(c1)c1ccccc1o[p+]2=O |
| InChI | InChI=1S/C20H24O2P/c1-5-13(3)15-11-17(14(4)6-2)20-18(12-15)16-9-7-8-10-19(16)22-23(20)21/h7-14H,5-6H2,1-4H3/q+1 |
| InChIKey | POOFOVVEMLHJMB-UHFFFAOYSA-N |
| XLogP | 7.36 |
| TPSA | 30.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.38 |
| LogP ≤ 5 | 7.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|