C15H22F3NO4S — CID 139756433
2,3-dimethyl-1-oxido-4-[2-[2-[2-(2,2,2-trifluoroethoxy)ethoxy]ethoxy]ethylsulfanyl]pyridin-1-ium (PubChem CID 139756433) has the molecular formula C15H22F3NO4S and a molecular weight of 369.41 g/mol. Its IUPAC name is 2,3-dimethyl-1-oxido-4-[2-[2-[2-(2,2,2-trifluoroethoxy)ethoxy]ethoxy]ethylsulfanyl]pyridin-1-ium.
| Compound Name | 2,3-dimethyl-1-oxido-4-[2-[2-[2-(2,2,2-trifluoroethoxy)ethoxy]ethoxy]ethylsulfanyl]pyridin-1-ium |
|---|---|
| PubChem CID | 139756433 |
| Molecular Formula | C15H22F3NO4S |
| Molecular Weight | 369.41 g/mol |
| Exact Mass | 369.12 |
| IUPAC Name | 2,3-dimethyl-1-oxido-4-[2-[2-[2-(2,2,2-trifluoroethoxy)ethoxy]ethoxy]ethylsulfanyl]pyridin-1-ium |
| SMILES | Cc1c(SCCOCCOCCOCC(F)(F)F)cc[n+]([O-])c1C |
| InChI | InChI=1S/C15H22F3NO4S/c1-12-13(2)19(20)4-3-14(12)24-10-9-22-6-5-21-7-8-23-11-15(16,17)18/h3-4H,5-11H2,1-2H3 |
| InChIKey | GZIXIECJDZOWMS-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 54.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.41 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|