C13H18F3NO2S — CID 54015749
2,3-dimethyl-4-[2-[2-(2,2,2-trifluoroethoxy)ethoxy]ethylsulfanyl]pyridine (PubChem CID 54015749) has the molecular formula C13H18F3NO2S and a molecular weight of 309.35 g/mol. Its IUPAC name is 2,3-dimethyl-4-[2-[2-(2,2,2-trifluoroethoxy)ethoxy]ethylsulfanyl]pyridine.
| Compound Name | 2,3-dimethyl-4-[2-[2-(2,2,2-trifluoroethoxy)ethoxy]ethylsulfanyl]pyridine |
|---|---|
| PubChem CID | 54015749 |
| Molecular Formula | C13H18F3NO2S |
| Molecular Weight | 309.35 g/mol |
| Exact Mass | 309.10 |
| IUPAC Name | 2,3-dimethyl-4-[2-[2-(2,2,2-trifluoroethoxy)ethoxy]ethylsulfanyl]pyridine |
| SMILES | Cc1nccc(SCCOCCOCC(F)(F)F)c1C |
| InChI | InChI=1S/C13H18F3NO2S/c1-10-11(2)17-4-3-12(10)20-8-7-18-5-6-19-9-13(14,15)16/h3-4H,5-9H2,1-2H3 |
| InChIKey | VLUQPRJZLSOBEQ-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 31.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.35 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|