C17H18F3NO2S — CID 162417476
4-[(1R)-1-(benzenesulfonyl)pentyl]-2-(trifluoromethyl)pyridine (PubChem CID 162417476) has the molecular formula C17H18F3NO2S and a molecular weight of 357.40 g/mol. Its IUPAC name is 4-[(1R)-1-(benzenesulfonyl)pentyl]-2-(trifluoromethyl)pyridine.
| Compound Name | 4-[(1R)-1-(benzenesulfonyl)pentyl]-2-(trifluoromethyl)pyridine |
|---|---|
| PubChem CID | 162417476 |
| Molecular Formula | C17H18F3NO2S |
| Molecular Weight | 357.40 g/mol |
| Exact Mass | 357.10 |
| IUPAC Name | 4-[(1R)-1-(benzenesulfonyl)pentyl]-2-(trifluoromethyl)pyridine |
| SMILES | CCCC[C@H](c1ccnc(C(F)(F)F)c1)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C17H18F3NO2S/c1-2-3-9-15(24(22,23)14-7-5-4-6-8-14)13-10-11-21-16(12-13)17(18,19)20/h4-8,10-12,15H,2-3,9H2,1H3/t15-/m1/s1 |
| InChIKey | QDEAYTQAJSXZSW-OAHLLOKOSA-N |
| XLogP | 4.81 |
| TPSA | 47.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.40 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |