C13H20FNO3S — CID 139756454
4-[2-[2-(2-fluoroethoxy)ethoxy]ethylsulfanyl]-2,3-dimethyl-1-oxidopyridin-1-ium (PubChem CID 139756454) has the molecular formula C13H20FNO3S and a molecular weight of 289.37 g/mol. Its IUPAC name is 4-[2-[2-(2-fluoroethoxy)ethoxy]ethylsulfanyl]-2,3-dimethyl-1-oxidopyridin-1-ium.
| Compound Name | 4-[2-[2-(2-fluoroethoxy)ethoxy]ethylsulfanyl]-2,3-dimethyl-1-oxidopyridin-1-ium |
|---|---|
| PubChem CID | 139756454 |
| Molecular Formula | C13H20FNO3S |
| Molecular Weight | 289.37 g/mol |
| Exact Mass | 289.11 |
| IUPAC Name | 4-[2-[2-(2-fluoroethoxy)ethoxy]ethylsulfanyl]-2,3-dimethyl-1-oxidopyridin-1-ium |
| SMILES | Cc1c(SCCOCCOCCF)cc[n+]([O-])c1C |
| InChI | InChI=1S/C13H20FNO3S/c1-11-12(2)15(16)5-3-13(11)19-10-9-18-8-7-17-6-4-14/h3,5H,4,6-10H2,1-2H3 |
| InChIKey | HJRDOMVCOARINT-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 45.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.37 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|