C51H40N4O5S2 — CID 139757587
benzhydryl (6R)-3-[(Z,3Z)-3-cyano-3-trityloxyiminoprop-1-enyl]sulfanyl-8-oxo-7-[(2-phenylacetyl)amino]-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate (PubChem CID 139757587) has the molecular formula C51H40N4O5S2 and a molecular weight of 853.04 g/mol. Its IUPAC name is benzhydryl (6R)-3-[(Z,3Z)-3-cyano-3-trityloxyiminoprop-1-enyl]sulfanyl-8-oxo-7-[(2-phenylacetyl)amino]-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate.
| Compound Name | benzhydryl (6R)-3-[(Z,3Z)-3-cyano-3-trityloxyiminoprop-1-enyl]sulfanyl-8-oxo-7-[(2-phenylacetyl)amino]-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate |
|---|---|
| PubChem CID | 139757587 |
| Molecular Formula | C51H40N4O5S2 |
| Molecular Weight | 853.04 g/mol |
| Exact Mass | 852.24 |
| IUPAC Name | benzhydryl (6R)-3-[(Z,3Z)-3-cyano-3-trityloxyiminoprop-1-enyl]sulfanyl-8-oxo-7-[(2-phenylacetyl)amino]-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate |
| SMILES | N#CC(/C=C\SC1=C(C(=O)OC(c2ccccc2)c2ccccc2)N2C(=O)C(NC(=O)Cc3ccccc3)[C@H]2SC1)=N\OC(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C51H40N4O5S2/c52-34-42(54-60-51(39-25-13-4-14-26-39,40-27-15-5-16-28-40)41-29-17-6-18-30-41)31-32-61-43-35-62-49-45(53-44(56)33-36-19-7-1-8-20-36)48(57)55(49)46(43)50(58)59-47(37-21-9-2-10-22-37)38-23-11-3-12-24-38/h1-32,45,47,49H,33,35H2,(H,53,56)/b32-31-,54-42-/t45?,49-/m1/s1 |
| InChIKey | FJPQRCLWJXBPEM-FLCZMNRLSA-N |
| XLogP | 9.31 |
| TPSA | 121.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 853.04 |
| LogP ≤ 5 | 9.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|