C13H28ClN — CID 139758911
methyl(2,3,4-trimethylnon-3-en-2-yl)azanium chloride (PubChem CID 139758911) has the molecular formula C13H28ClN and a molecular weight of 233.83 g/mol. Its IUPAC name is methyl(2,3,4-trimethylnon-3-en-2-yl)azanium chloride.
| Compound Name | methyl(2,3,4-trimethylnon-3-en-2-yl)azanium chloride |
|---|---|
| PubChem CID | 139758911 |
| Molecular Formula | C13H28ClN |
| Molecular Weight | 233.83 g/mol |
| Exact Mass | 233.19 |
| IUPAC Name | methyl(2,3,4-trimethylnon-3-en-2-yl)azanium chloride |
| SMILES | CCCCCC(C)=C(C)C(C)(C)[NH2+]C.[Cl-] |
| InChI | InChI=1S/C13H27N.ClH/c1-7-8-9-10-11(2)12(3)13(4,5)14-6;/h14H,7-10H2,1-6H3;1H |
| InChIKey | JUEVDNXHQXUWFI-UHFFFAOYSA-N |
| XLogP | -0.12 |
| TPSA | 16.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.83 |
| LogP ≤ 5 | -0.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|