C18H13ClN2O2S — CID 139761547
7-chloro-8-(isoquinolin-5-yloxymethyl)-4H-1,4-benzothiazin-3-one (PubChem CID 139761547) has the molecular formula C18H13ClN2O2S and a molecular weight of 356.83 g/mol. Its IUPAC name is 7-chloro-8-(isoquinolin-5-yloxymethyl)-4H-1,4-benzothiazin-3-one.
| Compound Name | 7-chloro-8-(isoquinolin-5-yloxymethyl)-4H-1,4-benzothiazin-3-one |
|---|---|
| PubChem CID | 139761547 |
| Molecular Formula | C18H13ClN2O2S |
| Molecular Weight | 356.83 g/mol |
| Exact Mass | 356.04 |
| IUPAC Name | 7-chloro-8-(isoquinolin-5-yloxymethyl)-4H-1,4-benzothiazin-3-one |
| SMILES | O=C1CSc2c(ccc(Cl)c2COc2cccc3cnccc23)N1 |
| InChI | InChI=1S/C18H13ClN2O2S/c19-14-4-5-15-18(24-10-17(22)21-15)13(14)9-23-16-3-1-2-11-8-20-7-6-12(11)16/h1-8H,9-10H2,(H,21,22) |
| InChIKey | UBERWBDFRNDLAW-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.83 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |